C16H23N5O2 — CID 118865750
methyl 3-[N-(2-aminoethyl)-5-methyl-2-(triazol-2-yl)anilino]butanoate (PubChem CID 118865750) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is methyl 3-[N-(2-aminoethyl)-5-methyl-2-(triazol-2-yl)anilino]butanoate.
| Compound Name | methyl 3-[N-(2-aminoethyl)-5-methyl-2-(triazol-2-yl)anilino]butanoate |
|---|---|
| PubChem CID | 118865750 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | methyl 3-[N-(2-aminoethyl)-5-methyl-2-(triazol-2-yl)anilino]butanoate |
| SMILES | COC(=O)CC(C)N(CCN)c1cc(C)ccc1-n1nccn1 |
| InChI | InChI=1S/C16H23N5O2/c1-12-4-5-14(21-18-7-8-19-21)15(10-12)20(9-6-17)13(2)11-16(22)23-3/h4-5,7-8,10,13H,6,9,11,17H2,1-3H3 |
| InChIKey | APAXHAUENFKVJV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |