About 4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine
4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine (PubChem CID 118865764) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine.
Molecular Properties
| Compound Name | 4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine |
| PubChem CID | 118865764 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine |
| SMILES | CC1COCN1CN1COCC1C |
| InChI | InChI=1S/C9H18N2O2/c1-8-3-12-6-10(8)5-11-7-13-4-9(11)2/h8-9H,3-7H2,1-2H3 |
| InChIKey | DXOGYGZNVYEDBP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine?
The IUPAC name of 4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine (CID 118865764) is 4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine.
What is the SMILES notation for 4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine?
The canonical SMILES for 4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine is CC1COCN1CN1COCC1C.
What is the InChIKey of 4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine?
The InChIKey is DXOGYGZNVYEDBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-8-3-12-6-10(8)5-11-7-13-4-9(11)2/h8-9H,3-7H2,1-2H3.
What are the key properties of 4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine?
4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine has a molecular weight of 186.25 g/mol, XLogP of 0.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-[(4-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine is sourced from PubChem (CID 118865764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).