C23H21F5N6OS — CID 118865842
(1S,5S,6S)-5-[2,3-difluoro-5-[[2-(3-fluoropropoxy)pyrido[3,4-b]pyrazin-5-yl]amino]phenyl]-1-(difluoromethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine (PubChem CID 118865842) has the molecular formula C23H21F5N6OS and a molecular weight of 524.52 g/mol. Its IUPAC name is (1S,5S,6S)-5-[2,3-difluoro-5-[[2-(3-fluoropropoxy)pyrido[3,4-b]pyrazin-5-yl]amino]phenyl]-1-(difluoromethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine.
| Compound Name | (1S,5S,6S)-5-[2,3-difluoro-5-[[2-(3-fluoropropoxy)pyrido[3,4-b]pyrazin-5-yl]amino]phenyl]-1-(difluoromethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine |
|---|---|
| PubChem CID | 118865842 |
| Molecular Formula | C23H21F5N6OS |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | (1S,5S,6S)-5-[2,3-difluoro-5-[[2-(3-fluoropropoxy)pyrido[3,4-b]pyrazin-5-yl]amino]phenyl]-1-(difluoromethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine |
| SMILES | C[C@]1(c2cc(Nc3nccc4nc(OCCCF)cnc34)cc(F)c2F)N=C(N)S[C@@]2(C(F)F)C[C@@H]12 |
| InChI | InChI=1S/C23H21F5N6OS/c1-22(15-9-23(15,20(27)28)36-21(29)34-22)12-7-11(8-13(25)17(12)26)32-19-18-14(3-5-30-19)33-16(10-31-18)35-6-2-4-24/h3,5,7-8,10,15,20H,2,4,6,9H2,1H3,(H2,29,34)(H,30,32)/t15-,22+,23-/m0/s1 |
| InChIKey | PMGKBGKTGXPEEX-BJQRDSPESA-N |
| XLogP | 5.09 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|