C19H25N3O3 — CID 11886587
(4aS,7aR)-3-benzyl-5-(3,3-dimethylbutanoyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 11886587) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is (4aS,7aR)-3-benzyl-5-(3,3-dimethylbutanoyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | (4aS,7aR)-3-benzyl-5-(3,3-dimethylbutanoyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11886587 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (4aS,7aR)-3-benzyl-5-(3,3-dimethylbutanoyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)CC(=O)N1CC[C@H]2NC(=O)N(Cc3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C19H25N3O3/c1-19(2,3)11-15(23)21-10-9-14-16(21)17(24)22(18(25)20-14)12-13-7-5-4-6-8-13/h4-8,14,16H,9-12H2,1-3H3,(H,20,25)/t14-,16+/m1/s1 |
| InChIKey | GOOFXDLKYJEJOT-ZBFHGGJFSA-N |
| XLogP | 2.14 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |