About tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid
tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid (PubChem CID 118865961) has the molecular formula C16H18F2N2O2S
and a molecular weight of 340.40 g/mol. Its IUPAC name is tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid.
Molecular Properties
| Compound Name | tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid |
| PubChem CID | 118865961 |
| Molecular Formula | C16H18F2N2O2S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1=N[C@](C)(c2cccc(F)c2F)C=CS1 |
| InChI | InChI=1S/C16H18F2N2O2S/c1-15(2,3)20(14(21)22)13-19-16(4,8-9-23-13)10-6-5-7-11(17)12(10)18/h5-9H,1-4H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | ZXXRNIKVTNNQIW-INIZCTEOSA-N |
| XLogP | 4.57 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid?
The IUPAC name of tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid (CID 118865961) is tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid.
What is the SMILES notation for tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid?
The canonical SMILES for tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid is CC(C)(C)N(C(=O)O)C1=N[C@](C)(c2cccc(F)c2F)C=CS1.
What is the InChIKey of tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid?
The InChIKey is ZXXRNIKVTNNQIW-INIZCTEOSA-N. The full InChI is InChI=1S/C16H18F2N2O2S/c1-15(2,3)20(14(21)22)13-19-16(4,8-9-23-13)10-6-5-7-11(17)12(10)18/h5-9H,1-4H3,(H,21,22)/t16-/m0/s1.
What are the key properties of tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid?
tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid has a molecular weight of 340.40 g/mol, XLogP of 4.57, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(4S)-4-(2,3-difluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid is sourced from PubChem (CID 118865961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).