C21H20ClF2N5O2S — CID 118866347
(1S,5S,6S)-3-amino-5-[5-[(5-chloropyridine-2-carbonyl)amino]-2,3-difluorophenyl]-N,N,5-trimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide (PubChem CID 118866347) has the molecular formula C21H20ClF2N5O2S and a molecular weight of 479.94 g/mol. Its IUPAC name is (1S,5S,6S)-3-amino-5-[5-[(5-chloropyridine-2-carbonyl)amino]-2,3-difluorophenyl]-N,N,5-trimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide.
| Compound Name | (1S,5S,6S)-3-amino-5-[5-[(5-chloropyridine-2-carbonyl)amino]-2,3-difluorophenyl]-N,N,5-trimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 118866347 |
| Molecular Formula | C21H20ClF2N5O2S |
| Molecular Weight | 479.94 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | (1S,5S,6S)-3-amino-5-[5-[(5-chloropyridine-2-carbonyl)amino]-2,3-difluorophenyl]-N,N,5-trimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide |
| SMILES | CN(C)C(=O)[C@]12C[C@H]1[C@@](C)(c1cc(NC(=O)c3ccc(Cl)cn3)cc(F)c1F)N=C(N)S2 |
| InChI | InChI=1S/C21H20ClF2N5O2S/c1-20(15-8-21(15,18(31)29(2)3)32-19(25)28-20)12-6-11(7-13(23)16(12)24)27-17(30)14-5-4-10(22)9-26-14/h4-7,9,15H,8H2,1-3H3,(H2,25,28)(H,27,30)/t15-,20+,21-/m0/s1 |
| InChIKey | RCUZRYJQRFWFIH-RVHYNSKXSA-N |
| XLogP | 3.39 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.94 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |