About 2-methoxypyrido[3,4-b]pyrazine
2-methoxypyrido[3,4-b]pyrazine (PubChem CID 118866436) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-methoxypyrido[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 2-methoxypyrido[3,4-b]pyrazine |
| PubChem CID | 118866436 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 2-methoxypyrido[3,4-b]pyrazine |
| SMILES | COc1cnc2cnccc2n1 |
| InChI | InChI=1S/C8H7N3O/c1-12-8-5-10-7-4-9-3-2-6(7)11-8/h2-5H,1H3 |
| InChIKey | CWZSDGWGEPKONM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxypyrido[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypyrido[3,4-b]pyrazine?
The IUPAC name of 2-methoxypyrido[3,4-b]pyrazine (CID 118866436) is 2-methoxypyrido[3,4-b]pyrazine.
What is the SMILES notation for 2-methoxypyrido[3,4-b]pyrazine?
The canonical SMILES for 2-methoxypyrido[3,4-b]pyrazine is COc1cnc2cnccc2n1.
What is the InChIKey of 2-methoxypyrido[3,4-b]pyrazine?
The InChIKey is CWZSDGWGEPKONM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c1-12-8-5-10-7-4-9-3-2-6(7)11-8/h2-5H,1H3.
What are the key properties of 2-methoxypyrido[3,4-b]pyrazine?
2-methoxypyrido[3,4-b]pyrazine has a molecular weight of 161.16 g/mol, XLogP of 1.03, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypyrido[3,4-b]pyrazine is sourced from PubChem (CID 118866436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).