C24H22F2N6O2S — CID 118866573
2-[[8-[3-[(1S,5S,6S)-3-amino-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4,5-difluoroanilino]-1,7-naphthyridin-3-yl]oxy]acetonitrile (PubChem CID 118866573) has the molecular formula C24H22F2N6O2S and a molecular weight of 496.54 g/mol. Its IUPAC name is 2-[[8-[3-[(1S,5S,6S)-3-amino-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4,5-difluoroanilino]-1,7-naphthyridin-3-yl]oxy]acetonitrile.
| Compound Name | 2-[[8-[3-[(1S,5S,6S)-3-amino-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4,5-difluoroanilino]-1,7-naphthyridin-3-yl]oxy]acetonitrile |
|---|---|
| PubChem CID | 118866573 |
| Molecular Formula | C24H22F2N6O2S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 2-[[8-[3-[(1S,5S,6S)-3-amino-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4,5-difluoroanilino]-1,7-naphthyridin-3-yl]oxy]acetonitrile |
| SMILES | COC[C@]12C[C@H]1[C@@](C)(c1cc(Nc3nccc4cc(OCC#N)cnc34)cc(F)c1F)N=C(N)S2 |
| InChI | InChI=1S/C24H22F2N6O2S/c1-23(18-10-24(18,12-33-2)35-22(28)32-23)16-8-14(9-17(25)19(16)26)31-21-20-13(3-5-29-21)7-15(11-30-20)34-6-4-27/h3,5,7-9,11,18H,6,10,12H2,1-2H3,(H2,28,32)(H,29,31)/t18-,23+,24+/m0/s1 |
| InChIKey | XBWHRXGJFIWUJK-NTUVXCKYSA-N |
| XLogP | 4.24 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |