C25H23F6N5O2S — CID 118866763
(1S,5S,6S)-5-[2,3-difluoro-5-[[3-(2,2,3,3-tetrafluoropropoxy)-1,7-naphthyridin-8-yl]amino]phenyl]-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine (PubChem CID 118866763) has the molecular formula C25H23F6N5O2S and a molecular weight of 571.55 g/mol. Its IUPAC name is (1S,5S,6S)-5-[2,3-difluoro-5-[[3-(2,2,3,3-tetrafluoropropoxy)-1,7-naphthyridin-8-yl]amino]phenyl]-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine.
| Compound Name | (1S,5S,6S)-5-[2,3-difluoro-5-[[3-(2,2,3,3-tetrafluoropropoxy)-1,7-naphthyridin-8-yl]amino]phenyl]-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine |
|---|---|
| PubChem CID | 118866763 |
| Molecular Formula | C25H23F6N5O2S |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | (1S,5S,6S)-5-[2,3-difluoro-5-[[3-(2,2,3,3-tetrafluoropropoxy)-1,7-naphthyridin-8-yl]amino]phenyl]-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine |
| SMILES | COC[C@]12C[C@H]1[C@@](C)(c1cc(Nc3nccc4cc(OCC(F)(F)C(F)F)cnc34)cc(F)c1F)N=C(N)S2 |
| InChI | InChI=1S/C25H23F6N5O2S/c1-23(17-8-24(17,10-37-2)39-22(32)36-23)15-6-13(7-16(26)18(15)27)35-20-19-12(3-4-33-20)5-14(9-34-19)38-11-25(30,31)21(28)29/h3-7,9,17,21H,8,10-11H2,1-2H3,(H2,32,36)(H,33,35)/t17-,23+,24+/m0/s1 |
| InChIKey | CSQMOOVCBXUVLZ-PKKBDPGCSA-N |
| XLogP | 5.61 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|