C17H10F8N4O2S — CID 118866889
N-[3-[(1S,5S,6S)-1-cyano-5-methyl-3-[(2,2,2-trifluoroacetyl)amino]-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4,5-difluorophenyl]-2,2,2-trifluoroacetamide (PubChem CID 118866889) has the molecular formula C17H10F8N4O2S and a molecular weight of 486.34 g/mol. Its IUPAC name is N-[3-[(1S,5S,6S)-1-cyano-5-methyl-3-[(2,2,2-trifluoroacetyl)amino]-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4,5-difluorophenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[(1S,5S,6S)-1-cyano-5-methyl-3-[(2,2,2-trifluoroacetyl)amino]-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4,5-difluorophenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 118866889 |
| Molecular Formula | C17H10F8N4O2S |
| Molecular Weight | 486.34 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | N-[3-[(1S,5S,6S)-1-cyano-5-methyl-3-[(2,2,2-trifluoroacetyl)amino]-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4,5-difluorophenyl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@]1(c2cc(NC(=O)C(F)(F)F)cc(F)c2F)N=C(NC(=O)C(F)(F)F)S[C@@]2(C#N)C[C@H]21 |
| InChI | InChI=1S/C17H10F8N4O2S/c1-14(7-2-6(3-8(18)10(7)19)27-11(30)16(20,21)22)9-4-15(9,5-26)32-13(29-14)28-12(31)17(23,24)25/h2-3,9H,4H2,1H3,(H,27,30)(H,28,29,31)/t9-,14+,15+/m0/s1 |
| InChIKey | NOZBJJWIQLEADA-TZTCFGBESA-N |
| XLogP | 3.74 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |