C25H23F2N5O2S — CID 118867012
(1S,5S,6S)-5-[2,3-difluoro-5-[(3-prop-2-ynoxy-1,7-naphthyridin-8-yl)amino]phenyl]-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine (PubChem CID 118867012) has the molecular formula C25H23F2N5O2S and a molecular weight of 495.56 g/mol. Its IUPAC name is (1S,5S,6S)-5-[2,3-difluoro-5-[(3-prop-2-ynoxy-1,7-naphthyridin-8-yl)amino]phenyl]-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine.
| Compound Name | (1S,5S,6S)-5-[2,3-difluoro-5-[(3-prop-2-ynoxy-1,7-naphthyridin-8-yl)amino]phenyl]-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine |
|---|---|
| PubChem CID | 118867012 |
| Molecular Formula | C25H23F2N5O2S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | (1S,5S,6S)-5-[2,3-difluoro-5-[(3-prop-2-ynoxy-1,7-naphthyridin-8-yl)amino]phenyl]-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine |
| SMILES | C#CCOc1cnc2c(Nc3cc(F)c(F)c([C@@]4(C)N=C(N)S[C@@]5(COC)C[C@H]54)c3)nccc2c1 |
| InChI | InChI=1S/C25H23F2N5O2S/c1-4-7-34-16-8-14-5-6-29-22(21(14)30-12-16)31-15-9-17(20(27)18(26)10-15)24(2)19-11-25(19,13-33-3)35-23(28)32-24/h1,5-6,8-10,12,19H,7,11,13H2,2-3H3,(H2,28,32)(H,29,31)/t19-,24+,25+/m0/s1 |
| InChIKey | VLQIYDCZABETQS-QTLGCAHFSA-N |
| XLogP | 4.35 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|