C22H29N3O4 — CID 118867314
(5Z,11R)-3-(2-oxo-2-piperidin-1-ylethyl)-11-phenyl-1-oxa-3,10-diazacyclododec-5-ene-2,9-dione (PubChem CID 118867314) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is (5Z,11R)-3-(2-oxo-2-piperidin-1-ylethyl)-11-phenyl-1-oxa-3,10-diazacyclododec-5-ene-2,9-dione.
| Compound Name | (5Z,11R)-3-(2-oxo-2-piperidin-1-ylethyl)-11-phenyl-1-oxa-3,10-diazacyclododec-5-ene-2,9-dione |
|---|---|
| PubChem CID | 118867314 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (5Z,11R)-3-(2-oxo-2-piperidin-1-ylethyl)-11-phenyl-1-oxa-3,10-diazacyclododec-5-ene-2,9-dione |
| SMILES | O=C1CC/C=C\CN(CC(=O)N2CCCCC2)C(=O)OC[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C22H29N3O4/c26-20-12-6-2-7-15-25(16-21(27)24-13-8-3-9-14-24)22(28)29-17-19(23-20)18-10-4-1-5-11-18/h1-2,4-5,7,10-11,19H,3,6,8-9,12-17H2,(H,23,26)/b7-2-/t19-/m0/s1 |
| InChIKey | HXHSVSMNEODJEZ-NRUPQRNLSA-N |
| XLogP | 2.64 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|