C15H25N4O2+ — CID 11886755
[(3S,3aR,6S,6aR)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]azanium (PubChem CID 11886755) has the molecular formula C15H25N4O2+ and a molecular weight of 293.39 g/mol. Its IUPAC name is [(3S,3aR,6S,6aR)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]azanium.
| Compound Name | [(3S,3aR,6S,6aR)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]azanium |
|---|---|
| PubChem CID | 11886755 |
| Molecular Formula | C15H25N4O2+ |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | [(3S,3aR,6S,6aR)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]azanium |
| SMILES | [NH3+][C@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1cc(CC2CCCCC2)nn1 |
| InChI | InChI=1S/C15H24N4O2/c16-12-8-20-15-13(9-21-14(12)15)19-7-11(17-18-19)6-10-4-2-1-3-5-10/h7,10,12-15H,1-6,8-9,16H2/p+1/t12-,13-,14+,15+/m0/s1 |
| InChIKey | ACPUVXGELYYVPR-BYNSBNAKSA-O |
| XLogP | 0.35 |
| TPSA | 76.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |