C17H22ClNO3 — CID 118867760
3-chloro-5-[[2-(2-hydroxybutan-2-yl)cyclohexen-1-yl]methoxy]pyridine-4-carbaldehyde (PubChem CID 118867760) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is 3-chloro-5-[[2-(2-hydroxybutan-2-yl)cyclohexen-1-yl]methoxy]pyridine-4-carbaldehyde.
| Compound Name | 3-chloro-5-[[2-(2-hydroxybutan-2-yl)cyclohexen-1-yl]methoxy]pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 118867760 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-chloro-5-[[2-(2-hydroxybutan-2-yl)cyclohexen-1-yl]methoxy]pyridine-4-carbaldehyde |
| SMILES | CCC(C)(O)C1=C(COc2cncc(Cl)c2C=O)CCCC1 |
| InChI | InChI=1S/C17H22ClNO3/c1-3-17(2,21)14-7-5-4-6-12(14)11-22-16-9-19-8-15(18)13(16)10-20/h8-10,21H,3-7,11H2,1-2H3 |
| InChIKey | ZNTSVPXJSUWQRO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|