C32H37N3O — CID 118867899
1-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-(pyridin-3-ylmethoxy)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole (PubChem CID 118867899) has the molecular formula C32H37N3O and a molecular weight of 479.67 g/mol. Its IUPAC name is 1-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-(pyridin-3-ylmethoxy)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole.
| Compound Name | 1-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-(pyridin-3-ylmethoxy)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole |
|---|---|
| PubChem CID | 118867899 |
| Molecular Formula | C32H37N3O |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | 1-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-(pyridin-3-ylmethoxy)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole |
| SMILES | C[C@]12CC[C@H](OCc3cccnc3)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(n3cnc4ccccc43)=CC[C@@H]12 |
| InChI | InChI=1S/C32H37N3O/c1-31-15-13-24(36-20-22-6-5-17-33-19-22)18-23(31)9-10-25-26-11-12-30(32(26,2)16-14-27(25)31)35-21-34-28-7-3-4-8-29(28)35/h3-9,12,17,19,21,24-27H,10-11,13-16,18,20H2,1-2H3/t24-,25-,26-,27-,31-,32-/m0/s1 |
| InChIKey | CJOOUKIWIHPTIL-CIISATOMSA-N |
| XLogP | 7.43 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|