C20H21N3O — CID 118868238
1-(1,3-dimethylpyrazol-4-yl)-N-(2-methoxy-4-methylphenyl)-1-phenylmethanimine (PubChem CID 118868238) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-N-(2-methoxy-4-methylphenyl)-1-phenylmethanimine.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-N-(2-methoxy-4-methylphenyl)-1-phenylmethanimine |
|---|---|
| PubChem CID | 118868238 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-N-(2-methoxy-4-methylphenyl)-1-phenylmethanimine |
| SMILES | COc1cc(C)ccc1/N=C(\c1ccccc1)c1cn(C)nc1C |
| InChI | InChI=1S/C20H21N3O/c1-14-10-11-18(19(12-14)24-4)21-20(16-8-6-5-7-9-16)17-13-23(3)22-15(17)2/h5-13H,1-4H3/b21-20+ |
| InChIKey | BUJKGILUUQGKKR-QZQOTICOSA-N |
| XLogP | 4.21 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|