C25H26N4O5 — CID 118868576
N-hydroxy-4-[(13-hydroxy-4,7-dioxo-6-propyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-17-yl)methyl]benzamide (PubChem CID 118868576) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is N-hydroxy-4-[(13-hydroxy-4,7-dioxo-6-propyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-17-yl)methyl]benzamide.
| Compound Name | N-hydroxy-4-[(13-hydroxy-4,7-dioxo-6-propyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-17-yl)methyl]benzamide |
|---|---|
| PubChem CID | 118868576 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-hydroxy-4-[(13-hydroxy-4,7-dioxo-6-propyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-17-yl)methyl]benzamide |
| SMILES | CCCN1CC(=O)N2Cc3c(c4cc(O)ccc4n3Cc3ccc(C(=O)NO)cc3)CC2C1=O |
| InChI | InChI=1S/C25H26N4O5/c1-2-9-27-14-23(31)29-13-22-19(11-21(29)25(27)33)18-10-17(30)7-8-20(18)28(22)12-15-3-5-16(6-4-15)24(32)26-34/h3-8,10,21,30,34H,2,9,11-14H2,1H3,(H,26,32) |
| InChIKey | GKESKPCZKUEYAM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|