C21H18F2N6O — CID 118869361
(3R)-4-[4-(2,6-difluoro-3-pyridinyl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-2-yl]-3-methylmorpholine (PubChem CID 118869361) has the molecular formula C21H18F2N6O and a molecular weight of 408.41 g/mol. Its IUPAC name is (3R)-4-[4-(2,6-difluoro-3-pyridinyl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-2-yl]-3-methylmorpholine.
| Compound Name | (3R)-4-[4-(2,6-difluoro-3-pyridinyl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-2-yl]-3-methylmorpholine |
|---|---|
| PubChem CID | 118869361 |
| Molecular Formula | C21H18F2N6O |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (3R)-4-[4-(2,6-difluoro-3-pyridinyl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-2-yl]-3-methylmorpholine |
| SMILES | C[C@@H]1COCCN1c1cc(-c2ccc(F)nc2F)c2ccnc(-c3ccn[nH]3)c2n1 |
| InChI | InChI=1S/C21H18F2N6O/c1-12-11-30-9-8-29(12)18-10-15(14-2-3-17(22)26-21(14)23)13-4-6-24-20(19(13)27-18)16-5-7-25-28-16/h2-7,10,12H,8-9,11H2,1H3,(H,25,28)/t12-/m1/s1 |
| InChIKey | MEMWYBNRXYNFCY-GFCCVEGCSA-N |
| XLogP | 3.59 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|