About [5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate
[5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate (PubChem CID 118869699) has the molecular formula C20H19F3N2O6S
and a molecular weight of 472.44 g/mol. Its IUPAC name is [5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate |
| PubChem CID | 118869699 |
| Molecular Formula | C20H19F3N2O6S |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | [5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate |
| SMILES | Cn1c(=O)n(CCCO)c(=O)c2c(Cc3ccccc3)c(OS(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H19F3N2O6S/c1-24-15-8-9-16(31-32(29,30)20(21,22)23)14(12-13-6-3-2-4-7-13)17(15)18(27)25(19(24)28)10-5-11-26/h2-4,6-9,26H,5,10-12H2,1H3 |
| InChIKey | OCJKCZWSKKDDBJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate?
The IUPAC name of [5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate (CID 118869699) is [5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate.
What is the SMILES notation for [5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate?
The canonical SMILES for [5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate is Cn1c(=O)n(CCCO)c(=O)c2c(Cc3ccccc3)c(OS(=O)(=O)C(F)(F)F)ccc21.
What is the InChIKey of [5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate?
The InChIKey is OCJKCZWSKKDDBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F3N2O6S/c1-24-15-8-9-16(31-32(29,30)20(21,22)23)14(12-13-6-3-2-4-7-13)17(15)18(27)25(19(24)28)10-5-11-26/h2-4,6-9,26H,5,10-12H2,1H3.
What are the key properties of [5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate?
[5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate has a molecular weight of 472.44 g/mol, XLogP of 1.90, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [5-benzyl-3-(3-hydroxypropyl)-1-methyl-2,4-dioxoquinazolin-6-yl] trifluoromethanesulfonate is sourced from PubChem (CID 118869699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).