C15H16FN5O2S — CID 118870126
4-[[2-(2-fluoroethyl)imidazol-1-yl]methyl]-1-(3-methylsulfonylphenyl)triazole (PubChem CID 118870126) has the molecular formula C15H16FN5O2S and a molecular weight of 349.39 g/mol. Its IUPAC name is 4-[[2-(2-fluoroethyl)imidazol-1-yl]methyl]-1-(3-methylsulfonylphenyl)triazole.
| Compound Name | 4-[[2-(2-fluoroethyl)imidazol-1-yl]methyl]-1-(3-methylsulfonylphenyl)triazole |
|---|---|
| PubChem CID | 118870126 |
| Molecular Formula | C15H16FN5O2S |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 4-[[2-(2-fluoroethyl)imidazol-1-yl]methyl]-1-(3-methylsulfonylphenyl)triazole |
| SMILES | CS(=O)(=O)c1cccc(-n2cc(Cn3ccnc3CCF)nn2)c1 |
| InChI | InChI=1S/C15H16FN5O2S/c1-24(22,23)14-4-2-3-13(9-14)21-11-12(18-19-21)10-20-8-7-17-15(20)5-6-16/h2-4,7-9,11H,5-6,10H2,1H3 |
| InChIKey | KLOSGRVATVPBIQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |