C23H25FN4O6 — CID 118870685
[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl] N-[(4R)-2-(2-ethoxyethyl)-3-oxo-1,2-oxazolidin-4-yl]carbamate (PubChem CID 118870685) has the molecular formula C23H25FN4O6 and a molecular weight of 472.47 g/mol. Its IUPAC name is [5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl] N-[(4R)-2-(2-ethoxyethyl)-3-oxo-1,2-oxazolidin-4-yl]carbamate.
| Compound Name | [5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl] N-[(4R)-2-(2-ethoxyethyl)-3-oxo-1,2-oxazolidin-4-yl]carbamate |
|---|---|
| PubChem CID | 118870685 |
| Molecular Formula | C23H25FN4O6 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | [5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl] N-[(4R)-2-(2-ethoxyethyl)-3-oxo-1,2-oxazolidin-4-yl]carbamate |
| SMILES | CCOCCN1OC[C@@H](NC(=O)Oc2c(C)[nH]c(/C=C3\C(=O)Nc4ccc(F)cc43)c2C)C1=O |
| InChI | InChI=1S/C23H25FN4O6/c1-4-32-8-7-28-22(30)19(11-33-28)27-23(31)34-20-12(2)18(25-13(20)3)10-16-15-9-14(24)5-6-17(15)26-21(16)29/h5-6,9-10,19,25H,4,7-8,11H2,1-3H3,(H,26,29)(H,27,31)/b16-10-/t19-/m1/s1 |
| InChIKey | MDLCJWBKDXSBCJ-NXIIHZOPSA-N |
| XLogP | 2.53 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|