C19H10ClF4N3O — CID 118870975
4-(3-chloro-4-fluorophenyl)-7-(2,3,4-trifluorophenyl)furo[2,3-c]pyridine-2,3-diamine (PubChem CID 118870975) has the molecular formula C19H10ClF4N3O and a molecular weight of 407.75 g/mol. Its IUPAC name is 4-(3-chloro-4-fluorophenyl)-7-(2,3,4-trifluorophenyl)furo[2,3-c]pyridine-2,3-diamine.
| Compound Name | 4-(3-chloro-4-fluorophenyl)-7-(2,3,4-trifluorophenyl)furo[2,3-c]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 118870975 |
| Molecular Formula | C19H10ClF4N3O |
| Molecular Weight | 407.75 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 4-(3-chloro-4-fluorophenyl)-7-(2,3,4-trifluorophenyl)furo[2,3-c]pyridine-2,3-diamine |
| SMILES | Nc1oc2c(-c3ccc(F)c(F)c3F)ncc(-c3ccc(F)c(Cl)c3)c2c1N |
| InChI | InChI=1S/C19H10ClF4N3O/c20-10-5-7(1-3-11(10)21)9-6-27-17(18-13(9)16(25)19(26)28-18)8-2-4-12(22)15(24)14(8)23/h1-6H,25-26H2 |
| InChIKey | CDTCJMMYEJUSGR-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.75 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|