About 4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine
4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine (PubChem CID 118871092) has the molecular formula C20H16ClFN4O
and a molecular weight of 382.83 g/mol. Its IUPAC name is 4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine |
| PubChem CID | 118871092 |
| Molecular Formula | C20H16ClFN4O |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine |
| SMILES | CCc1cc(-c2ncc(-c3ccc(F)c(Cl)c3)c3c(N)c(N)oc23)ccn1 |
| InChI | InChI=1S/C20H16ClFN4O/c1-2-12-7-11(5-6-25-12)18-19-16(17(23)20(24)27-19)13(9-26-18)10-3-4-15(22)14(21)8-10/h3-9H,2,23-24H2,1H3 |
| InChIKey | ASMQXTXXYARIIE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine?
The IUPAC name of 4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine (CID 118871092) is 4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine.
What is the SMILES notation for 4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine?
The canonical SMILES for 4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine is CCc1cc(-c2ncc(-c3ccc(F)c(Cl)c3)c3c(N)c(N)oc23)ccn1.
What is the InChIKey of 4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine?
The InChIKey is ASMQXTXXYARIIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClFN4O/c1-2-12-7-11(5-6-25-12)18-19-16(17(23)20(24)27-19)13(9-26-18)10-3-4-15(22)14(21)8-10/h3-9H,2,23-24H2,1H3.
What are the key properties of 4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine?
4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine has a molecular weight of 382.83 g/mol, XLogP of 5.08, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloro-4-fluorophenyl)-7-(2-ethyl-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine is sourced from PubChem (CID 118871092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).