C13H21NO — CID 11887118
N-[1-[(1S,4S)-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]propylidene]hydroxylamine (PubChem CID 11887118) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is N-[1-[(1S,4S)-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]propylidene]hydroxylamine.
| Compound Name | N-[1-[(1S,4S)-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]propylidene]hydroxylamine |
|---|---|
| PubChem CID | 11887118 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-[1-[(1S,4S)-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]propylidene]hydroxylamine |
| SMILES | CCC(=NO)C1=C[C@]2(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C13H21NO/c1-5-11(14-15)9-8-13(4)7-6-10(9)12(13,2)3/h8,10,15H,5-7H2,1-4H3/t10-,13+/m1/s1 |
| InChIKey | LMOJMDVHOXUIJK-MFKMUULPSA-N |
| XLogP | 3.61 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|