About [(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid
[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid (PubChem CID 118871803) has the molecular formula C11H14ClFN4O2
and a molecular weight of 288.71 g/mol. Its IUPAC name is [(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid.
Molecular Properties
| Compound Name | [(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid |
| PubChem CID | 118871803 |
| Molecular Formula | C11H14ClFN4O2 |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | [(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CCC[C@H](Nc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C11H14ClFN4O2/c12-10-14-5-8(13)9(17-10)15-6-2-1-3-7(4-6)16-11(18)19/h5-7,16H,1-4H2,(H,18,19)(H,14,15,17)/t6-,7+/m0/s1 |
| InChIKey | KDWXNPACODOEMM-NKWVEPMBSA-N |
| XLogP | 2.26 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid?
The IUPAC name of [(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid (CID 118871803) is [(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid.
What is the SMILES notation for [(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid?
The canonical SMILES for [(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid is O=C(O)N[C@@H]1CCC[C@H](Nc2nc(Cl)ncc2F)C1.
What is the InChIKey of [(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid?
The InChIKey is KDWXNPACODOEMM-NKWVEPMBSA-N. The full InChI is InChI=1S/C11H14ClFN4O2/c12-10-14-5-8(13)9(17-10)15-6-2-1-3-7(4-6)16-11(18)19/h5-7,16H,1-4H2,(H,18,19)(H,14,15,17)/t6-,7+/m0/s1.
What are the key properties of [(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid?
[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid has a molecular weight of 288.71 g/mol, XLogP of 2.26, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexyl]carbamic acid is sourced from PubChem (CID 118871803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).