About [4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid
[4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid (PubChem CID 118871904) has the molecular formula C12H9F3N2O2S
and a molecular weight of 302.28 g/mol. Its IUPAC name is [4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid |
| PubChem CID | 118871904 |
| Molecular Formula | C12H9F3N2O2S |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | [4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid |
| SMILES | O=C(O)NC1=NC(CF)(c2cccc(F)c2F)C=CS1 |
| InChI | InChI=1S/C12H9F3N2O2S/c13-6-12(7-2-1-3-8(14)9(7)15)4-5-20-10(17-12)16-11(18)19/h1-5H,6H2,(H,16,17)(H,18,19) |
| InChIKey | PDCVFVNOTZCIDM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid?
The IUPAC name of [4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid (CID 118871904) is [4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid.
What is the SMILES notation for [4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid?
The canonical SMILES for [4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid is O=C(O)NC1=NC(CF)(c2cccc(F)c2F)C=CS1.
What is the InChIKey of [4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid?
The InChIKey is PDCVFVNOTZCIDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F3N2O2S/c13-6-12(7-2-1-3-8(14)9(7)15)4-5-20-10(17-12)16-11(18)19/h1-5H,6H2,(H,16,17)(H,18,19).
What are the key properties of [4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid?
[4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid has a molecular weight of 302.28 g/mol, XLogP of 3.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,3-difluorophenyl)-4-(fluoromethyl)-1,3-thiazin-2-yl]carbamic acid is sourced from PubChem (CID 118871904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).