About 2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine
2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine (PubChem CID 118871956) has the molecular formula C13H10F3N5O2S
and a molecular weight of 357.32 g/mol. Its IUPAC name is 2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine.
Molecular Properties
| Compound Name | 2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine |
| PubChem CID | 118871956 |
| Molecular Formula | C13H10F3N5O2S |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine |
| SMILES | CCS(=O)(=O)c1cccnc1-n1cc2nnc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C13H10F3N5O2S/c1-2-24(22,23)10-4-3-5-17-12(10)21-7-9-8(20-21)6-11(19-18-9)13(14,15)16/h3-7H,2H2,1H3 |
| InChIKey | SOHNJFGECGWMDL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine?
The IUPAC name of 2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine (CID 118871956) is 2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine.
What is the SMILES notation for 2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine?
The canonical SMILES for 2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine is CCS(=O)(=O)c1cccnc1-n1cc2nnc(C(F)(F)F)cc2n1.
What is the InChIKey of 2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine?
The InChIKey is SOHNJFGECGWMDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3N5O2S/c1-2-24(22,23)10-4-3-5-17-12(10)21-7-9-8(20-21)6-11(19-18-9)13(14,15)16/h3-7H,2H2,1H3.
What are the key properties of 2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine?
2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine has a molecular weight of 357.32 g/mol, XLogP of 2.02, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethylsulfonyl-2-pyridinyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridazine is sourced from PubChem (CID 118871956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).