About 2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine
2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine (PubChem CID 118871975) has the molecular formula C15H12F3N3S
and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine.
Molecular Properties
| Compound Name | 2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine |
| PubChem CID | 118871975 |
| Molecular Formula | C15H12F3N3S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine |
| SMILES | CCSc1ccccc1-n1cc2cnc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C15H12F3N3S/c1-2-22-13-6-4-3-5-12(13)21-9-10-8-19-14(15(16,17)18)7-11(10)20-21/h3-9H,2H2,1H3 |
| InChIKey | TXTVVMMGBKHHJF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine?
The IUPAC name of 2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine (CID 118871975) is 2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine.
What is the SMILES notation for 2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine?
The canonical SMILES for 2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine is CCSc1ccccc1-n1cc2cnc(C(F)(F)F)cc2n1.
What is the InChIKey of 2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine?
The InChIKey is TXTVVMMGBKHHJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F3N3S/c1-2-22-13-6-4-3-5-12(13)21-9-10-8-19-14(15(16,17)18)7-11(10)20-21/h3-9H,2H2,1H3.
What are the key properties of 2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine?
2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine has a molecular weight of 323.34 g/mol, XLogP of 4.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylsulfanylphenyl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine is sourced from PubChem (CID 118871975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).