C17H17N3O4 — CID 118872383
(1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate (PubChem CID 118872383) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate.
| Compound Name | (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 118872383 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2[nH]c(=O)c3cnc(C4CCCCC4)n3c2c1 |
| InChI | InChI=1S/C17H17N3O4/c21-16-14-9-18-15(10-4-2-1-3-5-10)20(14)13-8-11(24-17(22)23)6-7-12(13)19-16/h6-10H,1-5H2,(H,19,21)(H,22,23) |
| InChIKey | CZGZXFFKTRDRMI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|