About (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate
(1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate (PubChem CID 118872383) has the molecular formula C17H17N3O4
and a molecular weight of 327.34 g/mol. Its IUPAC name is (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate |
| PubChem CID | 118872383 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2[nH]c(=O)c3cnc(C4CCCCC4)n3c2c1 |
| InChI | InChI=1S/C17H17N3O4/c21-16-14-9-18-15(10-4-2-1-3-5-10)20(14)13-8-11(24-17(22)23)6-7-12(13)19-16/h6-10H,1-5H2,(H,19,21)(H,22,23) |
| InChIKey | CZGZXFFKTRDRMI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate?
The IUPAC name of (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate (CID 118872383) is (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate.
What is the SMILES notation for (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate?
The canonical SMILES for (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate is O=C(O)Oc1ccc2[nH]c(=O)c3cnc(C4CCCCC4)n3c2c1.
What is the InChIKey of (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate?
The InChIKey is CZGZXFFKTRDRMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O4/c21-16-14-9-18-15(10-4-2-1-3-5-10)20(14)13-8-11(24-17(22)23)6-7-12(13)19-16/h6-10H,1-5H2,(H,19,21)(H,22,23).
What are the key properties of (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate?
(1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate has a molecular weight of 327.34 g/mol, XLogP of 3.28, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclohexyl-4-oxo-5H-imidazo[1,5-a]quinoxalin-8-yl) hydrogen carbonate is sourced from PubChem (CID 118872383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).