C29H44N2O7 — CID 118872688
[3-[2-aminoethoxycarbonyl(methyl)amino]-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate (PubChem CID 118872688) has the molecular formula C29H44N2O7 and a molecular weight of 532.68 g/mol. Its IUPAC name is [3-[2-aminoethoxycarbonyl(methyl)amino]-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate.
| Compound Name | [3-[2-aminoethoxycarbonyl(methyl)amino]-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate |
|---|---|
| PubChem CID | 118872688 |
| Molecular Formula | C29H44N2O7 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | [3-[2-aminoethoxycarbonyl(methyl)amino]-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate |
| SMILES | CC(=O)OC1CC2(O)C3CCC4CC(N(C)C(=O)OCCN)CCC4(C)C3CCC2(C)C1C1=CC(=O)OC1 |
| InChI | InChI=1S/C29H44N2O7/c1-17(32)38-23-15-29(35)22-6-5-19-14-20(31(4)26(34)36-12-11-30)7-9-27(19,2)21(22)8-10-28(29,3)25(23)18-13-24(33)37-16-18/h13,19-23,25,35H,5-12,14-16,30H2,1-4H3 |
| InChIKey | FTXMSDDZQYFRQS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|