C31H27F5N2O5 — CID 118872696
[2-[3-[[4-(4,5-difluoro-1-benzofuran-7-yl)phenoxy]methyl]-N-(piperidin-4-ylmethyl)anilino]acetyl] 2,2,2-trifluoroacetate (PubChem CID 118872696) has the molecular formula C31H27F5N2O5 and a molecular weight of 602.56 g/mol. Its IUPAC name is [2-[3-[[4-(4,5-difluoro-1-benzofuran-7-yl)phenoxy]methyl]-N-(piperidin-4-ylmethyl)anilino]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[[4-(4,5-difluoro-1-benzofuran-7-yl)phenoxy]methyl]-N-(piperidin-4-ylmethyl)anilino]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 118872696 |
| Molecular Formula | C31H27F5N2O5 |
| Molecular Weight | 602.56 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | [2-[3-[[4-(4,5-difluoro-1-benzofuran-7-yl)phenoxy]methyl]-N-(piperidin-4-ylmethyl)anilino]acetyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(CN(CC1CCNCC1)c1cccc(COc2ccc(-c3cc(F)c(F)c4ccoc34)cc2)c1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C31H27F5N2O5/c32-26-15-25(29-24(28(26)33)10-13-41-29)21-4-6-23(7-5-21)42-18-20-2-1-3-22(14-20)38(16-19-8-11-37-12-9-19)17-27(39)43-30(40)31(34,35)36/h1-7,10,13-15,19,37H,8-9,11-12,16-18H2 |
| InChIKey | IPAMUJMWTKQXRO-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.56 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|