C31H44N2O6 — CID 118872875
[(1R,2S,4R,6R,7R,10S,11S,14S,16R)-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl]-(2-morpholin-4-ylethyl)carbamic acid (PubChem CID 118872875) has the molecular formula C31H44N2O6 and a molecular weight of 540.70 g/mol. Its IUPAC name is [(1R,2S,4R,6R,7R,10S,11S,14S,16R)-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl]-(2-morpholin-4-ylethyl)carbamic acid.
| Compound Name | [(1R,2S,4R,6R,7R,10S,11S,14S,16R)-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl]-(2-morpholin-4-ylethyl)carbamic acid |
|---|---|
| PubChem CID | 118872875 |
| Molecular Formula | C31H44N2O6 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | [(1R,2S,4R,6R,7R,10S,11S,14S,16R)-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl]-(2-morpholin-4-ylethyl)carbamic acid |
| SMILES | C[C@]12CC[C@H](N(CCN3CCOCC3)C(=O)O)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](c3ccc(=O)oc3)C[C@H]3O[C@]132 |
| InChI | InChI=1S/C31H44N2O6/c1-29-9-7-22(33(28(35)36)12-11-32-13-15-37-16-14-32)17-21(29)4-5-24-23(29)8-10-30(2)25(18-26-31(24,30)39-26)20-3-6-27(34)38-19-20/h3,6,19,21-26H,4-5,7-18H2,1-2H3,(H,35,36)/t21-,22+,23+,24-,25-,26-,29+,30-,31-/m1/s1 |
| InChIKey | KYBXIRFCZLMGOM-YNVWBWBNSA-N |
| XLogP | 4.58 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|