About 1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine
1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine (PubChem CID 118873050) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine.
Molecular Properties
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine |
| PubChem CID | 118873050 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine |
| SMILES | CNC1CCN(CC2=CCCC=C2)CC1 |
| InChI | InChI=1S/C13H22N2/c1-14-13-7-9-15(10-8-13)11-12-5-3-2-4-6-12/h3,5-6,13-14H,2,4,7-11H2,1H3 |
| InChIKey | CTJGDZCYHGAVSC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine?
The IUPAC name of 1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine (CID 118873050) is 1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine.
What is the SMILES notation for 1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine?
The canonical SMILES for 1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine is CNC1CCN(CC2=CCCC=C2)CC1.
What is the InChIKey of 1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine?
The InChIKey is CTJGDZCYHGAVSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2/c1-14-13-7-9-15(10-8-13)11-12-5-3-2-4-6-12/h3,5-6,13-14H,2,4,7-11H2,1H3.
What are the key properties of 1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine?
1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine has a molecular weight of 206.33 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylpiperidin-4-amine is sourced from PubChem (CID 118873050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).