C26H24N2OS — CID 118873612
5-(4-phenylphenyl)-17-thia-5,12-diazatricyclo[12.2.1.02,6]heptadeca-1(16),2(6),3,14-tetraen-13-one (PubChem CID 118873612) has the molecular formula C26H24N2OS and a molecular weight of 412.56 g/mol. Its IUPAC name is 5-(4-phenylphenyl)-17-thia-5,12-diazatricyclo[12.2.1.02,6]heptadeca-1(16),2(6),3,14-tetraen-13-one.
| Compound Name | 5-(4-phenylphenyl)-17-thia-5,12-diazatricyclo[12.2.1.02,6]heptadeca-1(16),2(6),3,14-tetraen-13-one |
|---|---|
| PubChem CID | 118873612 |
| Molecular Formula | C26H24N2OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 5-(4-phenylphenyl)-17-thia-5,12-diazatricyclo[12.2.1.02,6]heptadeca-1(16),2(6),3,14-tetraen-13-one |
| SMILES | O=C1NCCCCCc2c(ccn2-c2ccc(-c3ccccc3)cc2)-c2ccc1s2 |
| InChI | InChI=1S/C26H24N2OS/c29-26-25-15-14-24(30-25)22-16-18-28(23(22)9-5-2-6-17-27-26)21-12-10-20(11-13-21)19-7-3-1-4-8-19/h1,3-4,7-8,10-16,18H,2,5-6,9,17H2,(H,27,29) |
| InChIKey | ZXSJIVMBCCGONF-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |