C33H40BrNO5 — CID 118873686
[(2S,4S)-6-[3-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-6-yl)methyl]-4-bromophenyl]-4-butoxy-6-methoxyoxan-2-yl]methanol (PubChem CID 118873686) has the molecular formula C33H40BrNO5 and a molecular weight of 610.59 g/mol. Its IUPAC name is [(2S,4S)-6-[3-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-6-yl)methyl]-4-bromophenyl]-4-butoxy-6-methoxyoxan-2-yl]methanol.
| Compound Name | [(2S,4S)-6-[3-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-6-yl)methyl]-4-bromophenyl]-4-butoxy-6-methoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 118873686 |
| Molecular Formula | C33H40BrNO5 |
| Molecular Weight | 610.59 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | [(2S,4S)-6-[3-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-6-yl)methyl]-4-bromophenyl]-4-butoxy-6-methoxyoxan-2-yl]methanol |
| SMILES | CCCCO[C@H]1C[C@@H](CO)OC(OC)(c2ccc(Br)c(Cc3ccc4c(c3)N(Cc3ccccc3)CCO4)c2)C1 |
| InChI | InChI=1S/C33H40BrNO5/c1-3-4-15-38-28-20-29(23-36)40-33(21-28,37-2)27-11-12-30(34)26(19-27)17-25-10-13-32-31(18-25)35(14-16-39-32)22-24-8-6-5-7-9-24/h5-13,18-19,28-29,36H,3-4,14-17,20-23H2,1-2H3/t28-,29-,33?/m0/s1 |
| InChIKey | KWJWANFEPIGRKD-QXSWOPKKSA-N |
| XLogP | 6.59 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.59 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|