C42H67N3O6 — CID 118874476
bis(2,2,6,6-tetramethylpiperidin-4-yl) 3-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylcyclohexyl]benzene-1,2-dicarboxylate (PubChem CID 118874476) has the molecular formula C42H67N3O6 and a molecular weight of 710.01 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 3-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylcyclohexyl]benzene-1,2-dicarboxylate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 3-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylcyclohexyl]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 118874476 |
| Molecular Formula | C42H67N3O6 |
| Molecular Weight | 710.01 g/mol |
| Exact Mass | 709.50 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 3-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylcyclohexyl]benzene-1,2-dicarboxylate |
| SMILES | CC1(C)CC(OC(=O)c2cccc(C3CCC(C(=O)OC4CC(C)(C)NC(C)(C)C4)CC3)c2C(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C42H67N3O6/c1-37(2)20-28(21-38(3,4)43-37)49-34(46)27-18-16-26(17-19-27)31-14-13-15-32(35(47)50-29-22-39(5,6)44-40(7,8)23-29)33(31)36(48)51-30-24-41(9,10)45-42(11,12)25-30/h13-15,26-30,43-45H,16-25H2,1-12H3 |
| InChIKey | WLOMTVQPXALHGN-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.01 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|