C33H43F2N3O4 — CID 118874528
(2,2,6,6-tetramethylpiperidin-4-yl) 6-[(E)-1,2-difluoro-2-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenyl]ethenyl]pyridine-3-carboxylate (PubChem CID 118874528) has the molecular formula C33H43F2N3O4 and a molecular weight of 583.72 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 6-[(E)-1,2-difluoro-2-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenyl]ethenyl]pyridine-3-carboxylate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 6-[(E)-1,2-difluoro-2-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenyl]ethenyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 118874528 |
| Molecular Formula | C33H43F2N3O4 |
| Molecular Weight | 583.72 g/mol |
| Exact Mass | 583.32 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 6-[(E)-1,2-difluoro-2-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenyl]ethenyl]pyridine-3-carboxylate |
| SMILES | CC1(C)CC(OC(=O)c2ccc(/C(F)=C(\F)c3ccc(C(=O)OC4CC(C)(C)NC(C)(C)C4)cn3)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C33H43F2N3O4/c1-30(2)15-23(16-31(3,4)37-30)41-28(39)21-11-9-20(10-12-21)26(34)27(35)25-14-13-22(19-36-25)29(40)42-24-17-32(5,6)38-33(7,8)18-24/h9-14,19,23-24,37-38H,15-18H2,1-8H3/b27-26+ |
| InChIKey | SMPOGZLBRVTWNY-CYYJNZCTSA-N |
| XLogP | 6.78 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.72 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |