About 3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine
3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine (PubChem CID 118874874) has the molecular formula C12H14N4O2
and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine |
| PubChem CID | 118874874 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine |
| SMILES | Nc1cccc(NC2=CCC(N)([N+](=O)[O-])C=C2)c1 |
| InChI | InChI=1S/C12H14N4O2/c13-9-2-1-3-11(8-9)15-10-4-6-12(14,7-5-10)16(17)18/h1-6,8,15H,7,13-14H2 |
| InChIKey | QREYAXLYFUXLGA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine?
The IUPAC name of 3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine (CID 118874874) is 3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine.
What is the SMILES notation for 3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine?
The canonical SMILES for 3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine is Nc1cccc(NC2=CCC(N)([N+](=O)[O-])C=C2)c1.
What is the InChIKey of 3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine?
The InChIKey is QREYAXLYFUXLGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2/c13-9-2-1-3-11(8-9)15-10-4-6-12(14,7-5-10)16(17)18/h1-6,8,15H,7,13-14H2.
What are the key properties of 3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine?
3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine has a molecular weight of 246.27 g/mol, XLogP of 1.46, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)benzene-1,3-diamine is sourced from PubChem (CID 118874874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).