C16H17FN6O — CID 118875011
5-(4-fluoroanilino)-8,11,11-trimethyl-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one (PubChem CID 118875011) has the molecular formula C16H17FN6O and a molecular weight of 328.35 g/mol. Its IUPAC name is 5-(4-fluoroanilino)-8,11,11-trimethyl-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one.
| Compound Name | 5-(4-fluoroanilino)-8,11,11-trimethyl-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 118875011 |
| Molecular Formula | C16H17FN6O |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 5-(4-fluoroanilino)-8,11,11-trimethyl-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(n[nH]c2Nc2ccc(F)cc2)N2CC(C)(C)N=C12 |
| InChI | InChI=1S/C16H17FN6O/c1-16(2)8-23-13-11(14(24)22(3)15(23)19-16)12(20-21-13)18-10-6-4-9(17)5-7-10/h4-7H,8H2,1-3H3,(H2,18,20,21) |
| InChIKey | SANWYHBDSQORBS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |