C25H21ClF3N4O5+ — CID 118875452
3-[5-[(4-chlorophenyl)methyl]-3-methyl-2,4-dioxo-6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-1H-pyrido[2,3-d]pyrimidin-3-ium-3-yl]propyl formate (PubChem CID 118875452) has the molecular formula C25H21ClF3N4O5+ and a molecular weight of 549.91 g/mol. Its IUPAC name is 3-[5-[(4-chlorophenyl)methyl]-3-methyl-2,4-dioxo-6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-1H-pyrido[2,3-d]pyrimidin-3-ium-3-yl]propyl formate.
| Compound Name | 3-[5-[(4-chlorophenyl)methyl]-3-methyl-2,4-dioxo-6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-1H-pyrido[2,3-d]pyrimidin-3-ium-3-yl]propyl formate |
|---|---|
| PubChem CID | 118875452 |
| Molecular Formula | C25H21ClF3N4O5+ |
| Molecular Weight | 549.91 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | 3-[5-[(4-chlorophenyl)methyl]-3-methyl-2,4-dioxo-6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-1H-pyrido[2,3-d]pyrimidin-3-ium-3-yl]propyl formate |
| SMILES | C[N+]1(CCCOC=O)C(=O)Nc2ncc(Oc3ccc(C(F)(F)F)nc3)c(Cc3ccc(Cl)cc3)c2C1=O |
| InChI | InChI=1S/C25H20ClF3N4O5/c1-33(9-2-10-37-14-34)23(35)21-18(11-15-3-5-16(26)6-4-15)19(13-31-22(21)32-24(33)36)38-17-7-8-20(30-12-17)25(27,28)29/h3-8,12-14H,2,9-11H2,1H3/p+1 |
| InChIKey | IEGOLMHZQBWTAP-UHFFFAOYSA-O |
| XLogP | 5.23 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.91 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|