C24H21ClFN4O5+ — CID 118875466
3-[5-[(4-chlorophenyl)methyl]-6-[(5-fluoro-3-pyridinyl)oxy]-3-methyl-2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-ium-3-yl]propyl formate (PubChem CID 118875466) has the molecular formula C24H21ClFN4O5+ and a molecular weight of 499.91 g/mol. Its IUPAC name is 3-[5-[(4-chlorophenyl)methyl]-6-[(5-fluoro-3-pyridinyl)oxy]-3-methyl-2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-ium-3-yl]propyl formate.
| Compound Name | 3-[5-[(4-chlorophenyl)methyl]-6-[(5-fluoro-3-pyridinyl)oxy]-3-methyl-2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-ium-3-yl]propyl formate |
|---|---|
| PubChem CID | 118875466 |
| Molecular Formula | C24H21ClFN4O5+ |
| Molecular Weight | 499.91 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 3-[5-[(4-chlorophenyl)methyl]-6-[(5-fluoro-3-pyridinyl)oxy]-3-methyl-2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-ium-3-yl]propyl formate |
| SMILES | C[N+]1(CCCOC=O)C(=O)Nc2ncc(Oc3cncc(F)c3)c(Cc3ccc(Cl)cc3)c2C1=O |
| InChI | InChI=1S/C24H20ClFN4O5/c1-30(7-2-8-34-14-31)23(32)21-19(9-15-3-5-16(25)6-4-15)20(13-28-22(21)29-24(30)33)35-18-10-17(26)11-27-12-18/h3-6,10-14H,2,7-9H2,1H3/p+1 |
| InChIKey | NCWGERFRWCUTRV-UHFFFAOYSA-O |
| XLogP | 4.35 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.91 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|