C25H24ClN4O5+ — CID 118875469
3-[5-[(4-chlorophenyl)methyl]-3-methyl-6-[(6-methyl-3-pyridinyl)oxy]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-ium-3-yl]propyl formate (PubChem CID 118875469) has the molecular formula C25H24ClN4O5+ and a molecular weight of 495.94 g/mol. Its IUPAC name is 3-[5-[(4-chlorophenyl)methyl]-3-methyl-6-[(6-methyl-3-pyridinyl)oxy]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-ium-3-yl]propyl formate.
| Compound Name | 3-[5-[(4-chlorophenyl)methyl]-3-methyl-6-[(6-methyl-3-pyridinyl)oxy]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-ium-3-yl]propyl formate |
|---|---|
| PubChem CID | 118875469 |
| Molecular Formula | C25H24ClN4O5+ |
| Molecular Weight | 495.94 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 3-[5-[(4-chlorophenyl)methyl]-3-methyl-6-[(6-methyl-3-pyridinyl)oxy]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-ium-3-yl]propyl formate |
| SMILES | Cc1ccc(Oc2cnc3c(c2Cc2ccc(Cl)cc2)C(=O)[N+](C)(CCCOC=O)C(=O)N3)cn1 |
| InChI | InChI=1S/C25H23ClN4O5/c1-16-4-9-19(13-27-16)35-21-14-28-23-22(20(21)12-17-5-7-18(26)8-6-17)24(32)30(2,25(33)29-23)10-3-11-34-15-31/h4-9,13-15H,3,10-12H2,1-2H3/p+1 |
| InChIKey | PHFHJCJVFHEVIA-UHFFFAOYSA-O |
| XLogP | 4.52 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.94 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|