C28H28ClN3O4 — CID 118875886
3-[5-[(4-chlorophenyl)methyl]-1-methyl-2,4-dioxo-6-(2-propan-2-ylphenyl)pyrido[2,3-d]pyrimidin-3-yl]propyl formate (PubChem CID 118875886) has the molecular formula C28H28ClN3O4 and a molecular weight of 506.00 g/mol. Its IUPAC name is 3-[5-[(4-chlorophenyl)methyl]-1-methyl-2,4-dioxo-6-(2-propan-2-ylphenyl)pyrido[2,3-d]pyrimidin-3-yl]propyl formate.
| Compound Name | 3-[5-[(4-chlorophenyl)methyl]-1-methyl-2,4-dioxo-6-(2-propan-2-ylphenyl)pyrido[2,3-d]pyrimidin-3-yl]propyl formate |
|---|---|
| PubChem CID | 118875886 |
| Molecular Formula | C28H28ClN3O4 |
| Molecular Weight | 506.00 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 3-[5-[(4-chlorophenyl)methyl]-1-methyl-2,4-dioxo-6-(2-propan-2-ylphenyl)pyrido[2,3-d]pyrimidin-3-yl]propyl formate |
| SMILES | CC(C)c1ccccc1-c1cnc2c(c1Cc1ccc(Cl)cc1)c(=O)n(CCCOC=O)c(=O)n2C |
| InChI | InChI=1S/C28H28ClN3O4/c1-18(2)21-7-4-5-8-22(21)24-16-30-26-25(23(24)15-19-9-11-20(29)12-10-19)27(34)32(28(35)31(26)3)13-6-14-36-17-33/h4-5,7-12,16-18H,6,13-15H2,1-3H3 |
| InChIKey | BMDBHZUNUAPVJP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.00 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|