About cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride
cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride (PubChem CID 118877263) has the molecular formula C13H17ClINO2
and a molecular weight of 381.64 g/mol. Its IUPAC name is cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride |
| PubChem CID | 118877263 |
| Molecular Formula | C13H17ClINO2 |
| Molecular Weight | 381.64 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride |
| SMILES | COC(=O)[C@@]1(N)CC[C@@H](c2ccc(I)cc2)C1.Cl |
| InChI | InChI=1S/C13H16INO2.ClH/c1-17-12(16)13(15)7-6-10(8-13)9-2-4-11(14)5-3-9;/h2-5,10H,6-8,15H2,1H3;1H/t10-,13-;/m1./s1 |
| InChIKey | BOTUXEWEURNSCL-HTMVYDOJSA-N |
| XLogP | 2.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.64 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride?
The IUPAC name of cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride (CID 118877263) is cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride.
What is the SMILES notation for cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride?
The canonical SMILES for cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride is COC(=O)[C@@]1(N)CC[C@@H](c2ccc(I)cc2)C1.Cl.
What is the InChIKey of cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride?
The InChIKey is BOTUXEWEURNSCL-HTMVYDOJSA-N. The full InChI is InChI=1S/C13H16INO2.ClH/c1-17-12(16)13(15)7-6-10(8-13)9-2-4-11(14)5-3-9;/h2-5,10H,6-8,15H2,1H3;1H/t10-,13-;/m1./s1.
What are the key properties of cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride?
cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride has a molecular weight of 381.64 g/mol, XLogP of 2.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1R,3R)-1-amino-3-(4-iodophenyl)cyclopentane-1-carboxylate;hydrochloride is sourced from PubChem (CID 118877263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).