C19H21NO2 — CID 118877282
(5R,8S)-8-(6-ethynyl-5,6,7,8-tetrahydronaphthalen-2-yl)-3-oxa-1-azaspiro[4.4]nonan-2-one (PubChem CID 118877282) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (5R,8S)-8-(6-ethynyl-5,6,7,8-tetrahydronaphthalen-2-yl)-3-oxa-1-azaspiro[4.4]nonan-2-one.
| Compound Name | (5R,8S)-8-(6-ethynyl-5,6,7,8-tetrahydronaphthalen-2-yl)-3-oxa-1-azaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 118877282 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (5R,8S)-8-(6-ethynyl-5,6,7,8-tetrahydronaphthalen-2-yl)-3-oxa-1-azaspiro[4.4]nonan-2-one |
| SMILES | C#CC1CCc2cc([C@H]3CC[C@]4(COC(=O)N4)C3)ccc2C1 |
| InChI | InChI=1S/C19H21NO2/c1-2-13-3-4-15-10-16(6-5-14(15)9-13)17-7-8-19(11-17)12-22-18(21)20-19/h1,5-6,10,13,17H,3-4,7-9,11-12H2,(H,20,21)/t13?,17-,19+/m0/s1 |
| InChIKey | FBDNAOOWJDZJKX-ZJLLDPBHSA-N |
| XLogP | 3.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|