C18H22O3 — CID 11887731
(1R,10S,11S,14S,15R,17R)-15-methyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-2(7),3,5-triene-5,14-diol (PubChem CID 11887731) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (1R,10S,11S,14S,15R,17R)-15-methyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-2(7),3,5-triene-5,14-diol.
| Compound Name | (1R,10S,11S,14S,15R,17R)-15-methyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-2(7),3,5-triene-5,14-diol |
|---|---|
| PubChem CID | 11887731 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (1R,10S,11S,14S,15R,17R)-15-methyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-2(7),3,5-triene-5,14-diol |
| SMILES | C[C@@]12C[C@H]3O[C@]34c3ccc(O)cc3CC[C@H]4[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C18H22O3/c1-17-9-16-18(21-16)12-5-3-11(19)8-10(12)2-4-14(18)13(17)6-7-15(17)20/h3,5,8,13-16,19-20H,2,4,6-7,9H2,1H3/t13-,14-,15-,16+,17+,18-/m0/s1 |
| InChIKey | MVSFFIDSUJVOMJ-WEVKCVHISA-N |
| XLogP | 2.73 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|