C29H44N2O5 — CID 118877337
tert-butyl (5R,8S)-8-[6-(butylcarbamoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl]-2,2-dimethyl-3-oxa-1-azaspiro[4.4]nonane-1-carboxylate (PubChem CID 118877337) has the molecular formula C29H44N2O5 and a molecular weight of 500.68 g/mol. Its IUPAC name is tert-butyl (5R,8S)-8-[6-(butylcarbamoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl]-2,2-dimethyl-3-oxa-1-azaspiro[4.4]nonane-1-carboxylate.
| Compound Name | tert-butyl (5R,8S)-8-[6-(butylcarbamoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl]-2,2-dimethyl-3-oxa-1-azaspiro[4.4]nonane-1-carboxylate |
|---|---|
| PubChem CID | 118877337 |
| Molecular Formula | C29H44N2O5 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | tert-butyl (5R,8S)-8-[6-(butylcarbamoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl]-2,2-dimethyl-3-oxa-1-azaspiro[4.4]nonane-1-carboxylate |
| SMILES | CCCCNC(=O)OC1CCc2cc([C@H]3CC[C@]4(COC(C)(C)N4C(=O)OC(C)(C)C)C3)ccc2C1 |
| InChI | InChI=1S/C29H44N2O5/c1-7-8-15-30-25(32)35-24-12-11-20-16-21(9-10-22(20)17-24)23-13-14-29(18-23)19-34-28(5,6)31(29)26(33)36-27(2,3)4/h9-10,16,23-24H,7-8,11-15,17-19H2,1-6H3,(H,30,32)/t23-,24?,29+/m0/s1 |
| InChIKey | WTLOEHZAJBBVFD-QFTSJRPJSA-N |
| XLogP | 6.08 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|