C8H10ClO2- — CID 11887748
(1S,2S,4R)-2-chlorobicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 11887748) has the molecular formula C8H10ClO2- and a molecular weight of 173.62 g/mol. Its IUPAC name is (1S,2S,4R)-2-chlorobicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (1S,2S,4R)-2-chlorobicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 11887748 |
| Molecular Formula | C8H10ClO2- |
| Molecular Weight | 173.62 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | (1S,2S,4R)-2-chlorobicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C([O-])[C@]1(Cl)C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C8H11ClO2/c9-8(7(10)11)4-5-1-2-6(8)3-5/h5-6H,1-4H2,(H,10,11)/p-1/t5-,6+,8+/m1/s1 |
| InChIKey | JUHQQBWZIAUSDN-CHKWXVPMSA-M |
| XLogP | 0.53 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.62 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|