C20H25NO3 — CID 118877573
3-[(2S)-6-[(5R,8S)-2-oxo-3-oxa-1-azaspiro[4.4]nonan-8-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]propanal (PubChem CID 118877573) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 3-[(2S)-6-[(5R,8S)-2-oxo-3-oxa-1-azaspiro[4.4]nonan-8-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]propanal.
| Compound Name | 3-[(2S)-6-[(5R,8S)-2-oxo-3-oxa-1-azaspiro[4.4]nonan-8-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]propanal |
|---|---|
| PubChem CID | 118877573 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 3-[(2S)-6-[(5R,8S)-2-oxo-3-oxa-1-azaspiro[4.4]nonan-8-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]propanal |
| SMILES | O=CCC[C@@H]1CCc2cc([C@H]3CC[C@]4(COC(=O)N4)C3)ccc2C1 |
| InChI | InChI=1S/C20H25NO3/c22-9-1-2-14-3-4-16-11-17(6-5-15(16)10-14)18-7-8-20(12-18)13-24-19(23)21-20/h5-6,9,11,14,18H,1-4,7-8,10,12-13H2,(H,21,23)/t14-,18+,20-/m1/s1 |
| InChIKey | ZVCURQXETWTRBP-HEFCMCLBSA-N |
| XLogP | 3.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|