About N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate
N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate (PubChem CID 118877769) has the molecular formula C9H10F6N2O5S2
and a molecular weight of 404.31 g/mol. Its IUPAC name is N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate |
| PubChem CID | 118877769 |
| Molecular Formula | C9H10F6N2O5S2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate |
| SMILES | CN(C)c1cc[n+](S(=O)(=O)C(F)(F)F)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C8H10F3N2O2S.CHF3O3S/c1-12(2)7-3-5-13(6-4-7)16(14,15)8(9,10)11;2-1(3,4)8(5,6)7/h3-6H,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | BZKYLFPVPWGLTP-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 98.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate?
The IUPAC name of N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate (CID 118877769) is N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate.
What is the SMILES notation for N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate?
The canonical SMILES for N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate is CN(C)c1cc[n+](S(=O)(=O)C(F)(F)F)cc1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate?
The InChIKey is BZKYLFPVPWGLTP-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10F3N2O2S.CHF3O3S/c1-12(2)7-3-5-13(6-4-7)16(14,15)8(9,10)11;2-1(3,4)8(5,6)7/h3-6H,1-2H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate?
N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate has a molecular weight of 404.31 g/mol, XLogP of 0.79, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-(trifluoromethylsulfonyl)pyridin-1-ium-4-amine;trifluoromethanesulfonate is sourced from PubChem (CID 118877769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).